Products 41242-94-8
CAS 41242-94-8 appears in our catalog under these names: Quinoxalin-2-ylmethanol, 98%, H-Imidazo(1,2-a)pyridine-3-carbaldehyde, Quinoxalin-2-ylmethanol 98%, Quinoxalin-2-ylmethanol, 98%, 98%, Quinoxalin-2-ylmethanol, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 250mg, 1g, 5g, 100mg, 500mg, 2.5g, 25g.
Quinoxalin-2-ylmethanol (CAS 41242-94-8) is a chemical compound with the molecular formula C9H8N2O and a molecular weight of 160.17 g/mol. IUPAC name: quinoxalin-2-ylmethanol. InChIKey: PZLGAOXMPNXQBW-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | quinoxalin-2-ylmethanol |
| InChIKey | PZLGAOXMPNXQBW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=CC(=N2)CO |
Computed by PubChem (NCBI)