CAS 41324-66-7 is the registry number for Benzyl l-prolinate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g.
Benzyl (2S)-pyrrolidine-2-carboxylate (CAS 41324-66-7) is a chemical compound with the molecular formula C12H15NO2 and a molecular weight of 205.25 g/mol. IUPAC name: benzyl (2S)-pyrrolidine-2-carboxylate. InChIKey: VVCLBQFBKZQOAF-NSHDSACASA-N.
| Molecular formula | C12H15NO2 |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | benzyl (2S)-pyrrolidine-2-carboxylate |
| InChIKey | VVCLBQFBKZQOAF-NSHDSACASA-N |
| SMILES | C1C[C@H](NC1)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)