Products 41552-12-9
CAS 41552-12-9 is the registry number for 1(2H)-Naphthalenone, 3,4-dihydro-5-hydroxy-6-nitro-, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-hydroxy-6-nitro-3,4-dihydro-2H-naphthalen-1-one (CAS 41552-12-9) is a chemical compound with the molecular formula C10H9NO4 and a molecular weight of 207.18 g/mol. IUPAC name: 5-hydroxy-6-nitro-3,4-dihydro-2H-naphthalen-1-one. InChIKey: CVGPERCYGCDJOW-UHFFFAOYSA-N.
| Molecular formula | C10H9NO4 |
|---|---|
| Molecular weight | 207.18 g/mol |
| IUPAC name | 5-hydroxy-6-nitro-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | CVGPERCYGCDJOW-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2O)[N+](=O)[O-])C(=O)C1 |
Computed by PubChem (NCBI)