CAS 41648-10-6 is the registry number for 6-((3,4-Dimethylphenyl)amino)pyrimidine-2,4(1H,3H)-dione, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.
6-(3,4-dimethylanilino)-1H-pyrimidine-2,4-dione (CAS 41648-10-6) is a chemical compound with the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. IUPAC name: 6-(3,4-dimethylanilino)-1H-pyrimidine-2,4-dione. InChIKey: DXOQUXIEIBVQHC-UHFFFAOYSA-N.
| Molecular formula | C12H13N3O2 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | 6-(3,4-dimethylanilino)-1H-pyrimidine-2,4-dione |
| InChIKey | DXOQUXIEIBVQHC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC2=CC(=O)NC(=O)N2)C |
Computed by PubChem (NCBI)