Products 41648-10-6

CAS 41648-10-6 is the registry number for 6-((3,4-Dimethylphenyl)amino)pyrimidine-2,4(1H,3H)-dione, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

6-(3,4-dimethylanilino)-1H-pyrimidine-2,4-dione (CAS 41648-10-6) is a chemical compound with the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. IUPAC name: 6-(3,4-dimethylanilino)-1H-pyrimidine-2,4-dione. InChIKey: DXOQUXIEIBVQHC-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13N3O2
Molecular weight231.25 g/mol
IUPAC name6-(3,4-dimethylanilino)-1H-pyrimidine-2,4-dione
InChIKeyDXOQUXIEIBVQHC-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1)NC2=CC(=O)NC(=O)N2)C

Computed by PubChem (NCBI)