Products 41651-87-0
CAS 41651-87-0 is the registry number for 4-{((Diaminomethylidene)amino)methyl}benzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-[(diaminomethylideneamino)methyl]benzoic acid (CAS 41651-87-0) is a chemical compound with the molecular formula C9H11N3O2 and a molecular weight of 193.20 g/mol. IUPAC name: 4-[(diaminomethylideneamino)methyl]benzoic acid. InChIKey: ZWKIKIJKGFTAAM-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O2 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | 4-[(diaminomethylideneamino)methyl]benzoic acid |
| InChIKey | ZWKIKIJKGFTAAM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN=C(N)N)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-{[(diaminomethylidene)amino]methyl}benzoic acid, 4-(((diaminomethylidene)amino)methyl)benzoic acid, p-guanidinomethyl benzoic acid, 4-[(diaminomethylideneamino)methyl]benzoic acid, 4-(((Diaminomethylene)amino)methyl)benzoic acid, 4-(guanidinomethyl)benzoic acid, starbld0007451, 4-Guanidinomethylbenzoic Acid, ZWKIKIJKGFTAAM-UHFFFAOYSA-N, Benzoic acid, 4-[[(aminoiminomethyl)amino]methyl]-