CAS 416886-60-7 is the registry number for 5,7-Dimethylquinolin-8-ol 1-oxide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5,7-dimethyl-1-oxidoquinolin-1-ium-8-ol (CAS 416886-60-7) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: 5,7-dimethyl-1-oxidoquinolin-1-ium-8-ol. InChIKey: PPWPWKBMHHTYNV-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 5,7-dimethyl-1-oxidoquinolin-1-ium-8-ol |
| InChIKey | PPWPWKBMHHTYNV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C2=C1C=CC=[N+]2[O-])O)C |
Computed by PubChem (NCBI)