CAS 41738-54-9 is the registry number for 3,7-Dimethyldibenzofuran. Offered by: TRC. Available pack sizes: 100mg.
3,7-dimethyldibenzofuran (CAS 41738-54-9) is a chemical compound with the molecular formula C14H12O and a molecular weight of 196.24 g/mol. IUPAC name: 3,7-dimethyldibenzofuran. InChIKey: VFCRTEVRAODBLT-UHFFFAOYSA-N.
| Molecular formula | C14H12O |
|---|---|
| Molecular weight | 196.24 g/mol |
| IUPAC name | 3,7-dimethyldibenzofuran |
| InChIKey | VFCRTEVRAODBLT-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C3=C(O2)C=C(C=C3)C |
Computed by PubChem (NCBI)