CAS 41738-56-1 appears in our catalog under these names: 2,2'–Diamino–(1,1'–biphenyl)–4,4'–dicarboxylic acid, 2,2'-Diamino-[1,1'-biphenyl]-4,4'-dicarboxylic acid, 97%, 97%, 2,2'-Diamino-[1,1'-biphenyl]-4,4'-dicarboxylic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 10g, 1g, 250mg, 5g.
3-amino-4-(2-amino-4-carboxyphenyl)benzoic acid (CAS 41738-56-1) is a chemical compound with the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. IUPAC name: 3-amino-4-(2-amino-4-carboxyphenyl)benzoic acid. InChIKey: AEZBIGVULSBTBA-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O4 |
|---|---|
| Molecular weight | 272.26 g/mol |
| IUPAC name | 3-amino-4-(2-amino-4-carboxyphenyl)benzoic acid |
| InChIKey | AEZBIGVULSBTBA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)N)C2=C(C=C(C=C2)C(=O)O)N |
Computed by PubChem (NCBI)