Products 41877-17-2
CAS 41877-17-2 appears in our catalog under these names: 2-Bromo-1-(4-hydroxy-3-methylphenyl)ethanone, 97%, 2-Bromo-1-(4-hydroxy-3-methylphenyl)ethan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 50mg, 0,5g.
2-bromo-1-(4-hydroxy-3-methylphenyl)ethanone (CAS 41877-17-2) is a chemical compound with the molecular formula C9H9BrO2 and a molecular weight of 229.07 g/mol. IUPAC name: 2-bromo-1-(4-hydroxy-3-methylphenyl)ethanone. InChIKey: UDORKTOXFJWYDF-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO2 |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | 2-bromo-1-(4-hydroxy-3-methylphenyl)ethanone |
| InChIKey | UDORKTOXFJWYDF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)CBr)O |
Computed by PubChem (NCBI)