Products 4193-42-4

CAS 4193-42-4 is the registry number for 5-Oxo-pyrrolidine-2-carboxylic acid o-tolylamide, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

N-(2-methylphenyl)-5-oxopyrrolidine-2-carboxamide (CAS 4193-42-4) is a chemical compound with the molecular formula C12H14N2O2 and a molecular weight of 218.25 g/mol. IUPAC name: N-(2-methylphenyl)-5-oxopyrrolidine-2-carboxamide. InChIKey: QDSSBKISDUDIEU-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14N2O2
Molecular weight218.25 g/mol
IUPAC nameN-(2-methylphenyl)-5-oxopyrrolidine-2-carboxamide
InChIKeyQDSSBKISDUDIEU-UHFFFAOYSA-N
SMILESCC1=CC=CC=C1NC(=O)C2CCC(=O)N2

Computed by PubChem (NCBI)