Products 41969-71-5
CAS 41969-71-5 appears in our catalog under these names: Diethyl 3,4-pyrroledicarboxylate, 95%, Diethyl 3,4-pyrroledicarboxylate, Diethyl 1H-pyrrole-3,4-dicarboxylate 97%, DIETHYL 3,4-PYRROLEDICARBOXYLATE, 98%, Diethyl 1H-pyrrole-3，4-dicarboxylate, 97%, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 5g, 10g, 1g, 2,5g, 100mg, 250mg, 25g.
Diethyl 1H-pyrrole-3,4-dicarboxylate (CAS 41969-71-5) is a chemical compound with the molecular formula C10H13NO4 and a molecular weight of 211.21 g/mol. IUPAC name: diethyl 1H-pyrrole-3,4-dicarboxylate. InChIKey: QKXBVVVYILIRDO-UHFFFAOYSA-N.
| Molecular formula | C10H13NO4 |
|---|---|
| Molecular weight | 211.21 g/mol |
| IUPAC name | diethyl 1H-pyrrole-3,4-dicarboxylate |
| InChIKey | QKXBVVVYILIRDO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CNC=C1C(=O)OCC |
Computed by PubChem (NCBI)
Synonyms:
Diethyl 3,4-pyrroledicarboxylate, diethyl 1H-pyrrole-3,4-dicarboxylate, 3,4-diethyl 1H-pyrrole-3,4-dicarboxylate, 1H-pyrrole-3,4-dicarboxylic acid diethyl ester, Diethyl pyrrole-3,4-dicarboxylate, DOWANOL(TM)PNB, Diethyl-3,4-pyrroledicarboxy, Diethyl-3,4-pyrroledicarboxylate, Diethyl 3,4-pyrroledicarboxylate, 98%