CAS 42145-38-0 appears in our catalog under these names: Dimethyl bicyclo[2.1.1]hexane-1,4-dicarboxylate, 95%, Dimethyl bicyclo[2.1.1]hexane-1,4-dicarboxylate 97%, Dimethyl Bicyclo[2.1.1]hexane-1,4-dicarboxylate, 97%, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 50mg, 500mg, 5g.
Dimethyl bicyclo[2.1.1]hexane-1,4-dicarboxylate (CAS 42145-38-0) is a chemical compound with the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. IUPAC name: dimethyl bicyclo[2.1.1]hexane-1,4-dicarboxylate. InChIKey: OWFFQFMDATXZDF-UHFFFAOYSA-N.
| Molecular formula | C10H14O4 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | dimethyl bicyclo[2.1.1]hexane-1,4-dicarboxylate |
| InChIKey | OWFFQFMDATXZDF-UHFFFAOYSA-N |
| SMILES | COC(=O)C12CCC(C1)(C2)C(=O)OC |
Computed by PubChem (NCBI)