CAS 70589-07-0 is the registry number for 3-Hydrazinyl-6-(1H-pyrazol-1-yl)pyridazine. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
(6-pyrazol-1-ylpyridazin-3-yl)hydrazine (CAS 70589-07-0) is a chemical compound with the molecular formula C7H8N6 and a molecular weight of 176.18 g/mol. IUPAC name: (6-pyrazol-1-ylpyridazin-3-yl)hydrazine. InChIKey: GJNSELBGDLLJPP-UHFFFAOYSA-N.
| Molecular formula | C7H8N6 |
|---|---|
| Molecular weight | 176.18 g/mol |
| IUPAC name | (6-pyrazol-1-ylpyridazin-3-yl)hydrazine |
| InChIKey | GJNSELBGDLLJPP-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1)C2=NN=C(C=C2)NN |
Computed by PubChem (NCBI)