Products 421573-09-3
CAS 421573-09-3 is the registry number for Mycobactin-IN-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[5-(4-bromophenyl)-4,5-dihydro-1H-pyrazol-3-yl]phenol (CAS 421573-09-3) is a chemical compound with the molecular formula C15H13BrN2O and a molecular weight of 317.18 g/mol. IUPAC name: 2-[5-(4-bromophenyl)-4,5-dihydro-1H-pyrazol-3-yl]phenol. InChIKey: ARSOKDMOVPQBQS-UHFFFAOYSA-N.
| Molecular formula | C15H13BrN2O |
|---|---|
| Molecular weight | 317.18 g/mol |
| IUPAC name | 2-[5-(4-bromophenyl)-4,5-dihydro-1H-pyrazol-3-yl]phenol |
| InChIKey | ARSOKDMOVPQBQS-UHFFFAOYSA-N |
| SMILES | C1C(NN=C1C2=CC=CC=C2O)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)
Synonyms:
Mycobactin-IN-2, orb1689200