CAS 42196-29-2 is the registry number for 2-Bromo-1,4-bis(propan-2-yl)benzene. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
2-bromo-1,4-di(propan-2-yl)benzene (CAS 42196-29-2) is a chemical compound with the molecular formula C12H17Br and a molecular weight of 241.17 g/mol. IUPAC name: 2-bromo-1,4-di(propan-2-yl)benzene. InChIKey: KSFMKBVDTMONEL-UHFFFAOYSA-N.
| Molecular formula | C12H17Br |
|---|---|
| Molecular weight | 241.17 g/mol |
| IUPAC name | 2-bromo-1,4-di(propan-2-yl)benzene |
| InChIKey | KSFMKBVDTMONEL-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(C=C1)C(C)C)Br |
Computed by PubChem (NCBI)