CAS 56829-61-9 is the registry number for 1-(2-Bromoethyl)-4-(tert-butyl)benzene 95%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg.
1-(2-bromoethyl)-4-tert-butylbenzene (CAS 56829-61-9) is a chemical compound with the molecular formula C12H17Br and a molecular weight of 241.17 g/mol. IUPAC name: 1-(2-bromoethyl)-4-tert-butylbenzene. InChIKey: AZDUTYBFMRTGFJ-UHFFFAOYSA-N.
| Molecular formula | C12H17Br |
|---|---|
| Molecular weight | 241.17 g/mol |
| IUPAC name | 1-(2-bromoethyl)-4-tert-butylbenzene |
| InChIKey | AZDUTYBFMRTGFJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)CCBr |
Computed by PubChem (NCBI)