CAS 5345-05-1 appears in our catalog under these names: 2-Bromo-5-tert-butyl-1,3-dimethylbenzene, >98.0%(GC), 2-Bromo-5-(tert-butyl)-1,3-dimethylbenzene 95%, 2-Bromo-5-(tert-butyl)-1,3-dimethylbenzene, 95%, 95%. Offered by: TCI, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 10g, 25g, 100g, 100mg.
2-bromo-5-tert-butyl-1,3-dimethylbenzene (CAS 5345-05-1) is a chemical compound with the molecular formula C12H17Br and a molecular weight of 241.17 g/mol. IUPAC name: 2-bromo-5-tert-butyl-1,3-dimethylbenzene. InChIKey: HAIGIJCTBFVMEP-UHFFFAOYSA-N.
| Molecular formula | C12H17Br |
|---|---|
| Molecular weight | 241.17 g/mol |
| IUPAC name | 2-bromo-5-tert-butyl-1,3-dimethylbenzene |
| InChIKey | HAIGIJCTBFVMEP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1Br)C)C(C)(C)C |
Computed by PubChem (NCBI)