CAS 91-06-5 is the registry number for 1–BROMO–2,4,6–TRIETHYLBENZENE. Offered by: GLPBio. Available pack sizes: 1g.
2-bromo-1,3,5-triethylbenzene (CAS 91-06-5) is a chemical compound with the molecular formula C12H17Br and a molecular weight of 241.17 g/mol. IUPAC name: 2-bromo-1,3,5-triethylbenzene. InChIKey: GYPGUOPEQLYKQZ-UHFFFAOYSA-N.
| Molecular formula | C12H17Br |
|---|---|
| Molecular weight | 241.17 g/mol |
| IUPAC name | 2-bromo-1,3,5-triethylbenzene |
| InChIKey | GYPGUOPEQLYKQZ-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=C(C(=C1)CC)Br)CC |
Computed by PubChem (NCBI)