CAS 42276-56-2 is the registry number for 2-Bromo-n-mesitylbutanamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-bromo-N-(2,4,6-trimethylphenyl)butanamide (CAS 42276-56-2) is a chemical compound with the molecular formula C13H18BrNO and a molecular weight of 284.19 g/mol. IUPAC name: 2-bromo-N-(2,4,6-trimethylphenyl)butanamide. InChIKey: KDDUDDQUHKRRBN-UHFFFAOYSA-N.
| Molecular formula | C13H18BrNO |
|---|---|
| Molecular weight | 284.19 g/mol |
| IUPAC name | 2-bromo-N-(2,4,6-trimethylphenyl)butanamide |
| InChIKey | KDDUDDQUHKRRBN-UHFFFAOYSA-N |
| SMILES | CCC(C(=O)NC1=C(C=C(C=C1C)C)C)Br |
Computed by PubChem (NCBI)