CAS 42348-89-0 appears in our catalog under these names: 6-Isopropyl-2,3-dihydro-1H-inden-1-one, 95%, 6-Isopropyl-2,3-dihydro-1H-inden-1-one, 95%, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g.
6-propan-2-yl-2,3-dihydroinden-1-one (CAS 42348-89-0) is a chemical compound with the molecular formula C12H14O and a molecular weight of 174.24 g/mol. IUPAC name: 6-propan-2-yl-2,3-dihydroinden-1-one. InChIKey: DUYPYGNHXIOWBV-UHFFFAOYSA-N.
| Molecular formula | C12H14O |
|---|---|
| Molecular weight | 174.24 g/mol |
| IUPAC name | 6-propan-2-yl-2,3-dihydroinden-1-one |
| InChIKey | DUYPYGNHXIOWBV-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC2=C(CCC2=O)C=C1 |
Computed by PubChem (NCBI)