Products 423768-54-1
CAS 423768-54-1 appears in our catalog under these names: 2-Morpholinonicotinic acid, 96%, 2-Morpholinopyridine-3-carboxylic acid, 2-Morpholinonicotinic acid, 97% , 2-Morpholinonicotinic acid 97%, 2-Morpholinonicotinic acid, 97%, 97%. Offered by: Combi-blocks, Biosynth, Thermo Scientific, Ambeed, Chemat. Available pack sizes: 5g, 10g, 25g, 1g, 100g, 250mg.
2-morpholin-4-ylpyridine-3-carboxylic acid (CAS 423768-54-1) is a chemical compound with the molecular formula C10H12N2O3 and a molecular weight of 208.21 g/mol. IUPAC name: 2-morpholin-4-ylpyridine-3-carboxylic acid. InChIKey: YDUPMJIUJMCXAL-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O3 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | 2-morpholin-4-ylpyridine-3-carboxylic acid |
| InChIKey | YDUPMJIUJMCXAL-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=C(C=CC=N2)C(=O)O |
Computed by PubChem (NCBI)