Products 42528-66-5
CAS 42528-66-5 is the registry number for 1-(3-Aminophenyl)-2-methylpropan-1-one hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(3-aminophenyl)-2-methylpropan-1-one;hydrochloride (CAS 42528-66-5) is a chemical compound with the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. IUPAC name: 1-(3-aminophenyl)-2-methylpropan-1-one;hydrochloride. InChIKey: XYIAYOBFGPNLFW-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO |
|---|---|
| Molecular weight | 199.68 g/mol |
| IUPAC name | 1-(3-aminophenyl)-2-methylpropan-1-one;hydrochloride |
| InChIKey | XYIAYOBFGPNLFW-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)C1=CC(=CC=C1)N.Cl |
Computed by PubChem (NCBI)