CAS 4277-02-5 is the registry number for 3,5-Dinitrophthalic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3,5-dinitrophthalic acid (CAS 4277-02-5) is a chemical compound with the molecular formula C8H4N2O8 and a molecular weight of 256.13 g/mol. IUPAC name: 3,5-dinitrophthalic acid. InChIKey: POYFAWOYINUXAW-UHFFFAOYSA-N.
| Molecular formula | C8H4N2O8 |
|---|---|
| Molecular weight | 256.13 g/mol |
| IUPAC name | 3,5-dinitrophthalic acid |
| InChIKey | POYFAWOYINUXAW-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)C(=O)O)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)