Products 4277-02-5

CAS 4277-02-5 is the registry number for 3,5-Dinitrophthalic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

3,5-dinitrophthalic acid (CAS 4277-02-5) is a chemical compound with the molecular formula C8H4N2O8 and a molecular weight of 256.13 g/mol. IUPAC name: 3,5-dinitrophthalic acid. InChIKey: POYFAWOYINUXAW-UHFFFAOYSA-N.

Identity
Molecular formulaC8H4N2O8
Molecular weight256.13 g/mol
IUPAC name3,5-dinitrophthalic acid
InChIKeyPOYFAWOYINUXAW-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1C(=O)O)C(=O)O)[N+](=O)[O-])[N+](=O)[O-]

Computed by PubChem (NCBI)