Products 90348-28-0
CAS 90348-28-0 is the registry number for 1,2-Benzenedicarboxylicacid, 4,5-dinitro-, >95%, >95%. Offered by: Chemat. Available pack sizes: 50mg, 250mg, 1g.
4,5-dinitrophthalic acid (CAS 90348-28-0) is a chemical compound with the molecular formula C8H4N2O8 and a molecular weight of 256.13 g/mol. IUPAC name: 4,5-dinitrophthalic acid. InChIKey: MJJVUJBKOFXFJW-UHFFFAOYSA-N.
| Molecular formula | C8H4N2O8 |
|---|---|
| Molecular weight | 256.13 g/mol |
| IUPAC name | 4,5-dinitrophthalic acid |
| InChIKey | MJJVUJBKOFXFJW-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1[N+](=O)[O-])[N+](=O)[O-])C(=O)O)C(=O)O |
Computed by PubChem (NCBI)