CAS 42779-84-0 appears in our catalog under these names: [2,5-Dimethyl-1-(4-methylphenyl)-1h-pyrrol-3-yl]acetic acid, 95%, 2-(2,5-Dimethyl-1-(p-tolyl)-1H-pyrrol-3-yl)acetic acid, 97%, 2-(2,5-Dimethyl-1-(4-methylphenyl)-1H-pyrrol-3-yl)acetic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
2-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]acetic acid (CAS 42779-84-0) is a chemical compound with the molecular formula C15H17NO2 and a molecular weight of 243.30 g/mol. IUPAC name: 2-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]acetic acid. InChIKey: UUVCVTSSMHFGDP-UHFFFAOYSA-N.
| Molecular formula | C15H17NO2 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | 2-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]acetic acid |
| InChIKey | UUVCVTSSMHFGDP-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C(=CC(=C2C)CC(=O)O)C |
Computed by PubChem (NCBI)