Products 427896-41-1
CAS 427896-41-1 appears in our catalog under these names: 2-tert-Butyl-4-methyl-1,3-thiazole-5-carboxylic acid, 95%, 2-(tert-Butyl)-4-methylthiazole-5-carboxylic acid, 95+%, 2-tert-butyl-4-methyl-1,3-thiazole-5-carboxylic acid, 95+%, 95+%, 2-(TERT-BUTYL)-4-METHYLTHIAZOLE-5-CARBOXYLIC ACID, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 10g, 1g, 250mg.
2-tert-butyl-4-methyl-1,3-thiazole-5-carboxylic acid (CAS 427896-41-1) is a chemical compound with the molecular formula C9H13NO2S and a molecular weight of 199.27 g/mol. IUPAC name: 2-tert-butyl-4-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: YHLQWXNPKLIQMJ-UHFFFAOYSA-N.
| Molecular formula | C9H13NO2S |
|---|---|
| Molecular weight | 199.27 g/mol |
| IUPAC name | 2-tert-butyl-4-methyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | YHLQWXNPKLIQMJ-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)