Products 42832-22-4
CAS 42832-22-4 appears in our catalog under these names: Methyl 4–(dimethylamino)–2–methoxybenzoate, METHYL 4-(DIMETHYLAMINO)-2-METHOXYBENZOATE, 95%, 4-Dimethylamino-2-methoxy-benzoic acid methyl ester, 95%, Amisulpride Impurity 9, 4-Dimethylamino-2-methoxy-benzoic acid methyl ester, 95%, 95%. Offered by: GLPBio, Fluorochem, Combi-blocks, Chemat Brand, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, on request.
Methyl 4-(dimethylamino)-2-methoxybenzoate (CAS 42832-22-4) is a chemical compound with the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. IUPAC name: methyl 4-(dimethylamino)-2-methoxybenzoate. InChIKey: OEFMHCGYQLYADE-UHFFFAOYSA-N.
| Molecular formula | C11H15NO3 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | methyl 4-(dimethylamino)-2-methoxybenzoate |
| InChIKey | OEFMHCGYQLYADE-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC(=C(C=C1)C(=O)OC)OC |
Computed by PubChem (NCBI)