CAS 428848-38-8 is the registry number for Methyl 4-(2,5-dimethyl-1H-pyrrol-1-yl)-3-methylbenzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-(2,5-dimethylpyrrol-1-yl)-3-methylbenzoate (CAS 428848-38-8) is a chemical compound with the molecular formula C15H17NO2 and a molecular weight of 243.30 g/mol. IUPAC name: methyl 4-(2,5-dimethylpyrrol-1-yl)-3-methylbenzoate. InChIKey: IFWZVAVCVVIKEO-UHFFFAOYSA-N.
| Molecular formula | C15H17NO2 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | methyl 4-(2,5-dimethylpyrrol-1-yl)-3-methylbenzoate |
| InChIKey | IFWZVAVCVVIKEO-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(N1C2=C(C=C(C=C2)C(=O)OC)C)C |
Computed by PubChem (NCBI)