Products 42946-50-9

CAS 42946-50-9 is the registry number for 9-Oxo-xanthene-2-carboxylic Acid Methyl Ester. Offered by: TRC. Available pack sizes: 2,5g.

Structural formula: {0} (CAS {1})

Methyl 9-oxoxanthene-2-carboxylate (CAS 42946-50-9) is a chemical compound with the molecular formula C15H10O4 and a molecular weight of 254.24 g/mol. IUPAC name: methyl 9-oxoxanthene-2-carboxylate. InChIKey: KYTOGJKXWOZHFR-UHFFFAOYSA-N.

Identity
Molecular formulaC15H10O4
Molecular weight254.24 g/mol
IUPAC namemethyl 9-oxoxanthene-2-carboxylate
InChIKeyKYTOGJKXWOZHFR-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC2=C(C=C1)OC3=CC=CC=C3C2=O

Computed by PubChem (NCBI)