CAS 42946-50-9 is the registry number for 9-Oxo-xanthene-2-carboxylic Acid Methyl Ester. Offered by: TRC. Available pack sizes: 2,5g.
Methyl 9-oxoxanthene-2-carboxylate (CAS 42946-50-9) is a chemical compound with the molecular formula C15H10O4 and a molecular weight of 254.24 g/mol. IUPAC name: methyl 9-oxoxanthene-2-carboxylate. InChIKey: KYTOGJKXWOZHFR-UHFFFAOYSA-N.
| Molecular formula | C15H10O4 |
|---|---|
| Molecular weight | 254.24 g/mol |
| IUPAC name | methyl 9-oxoxanthene-2-carboxylate |
| InChIKey | KYTOGJKXWOZHFR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)OC3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)