Products 4295-55-0
CAS 4295-55-0 is the registry number for 2-((2,3-Dichlorophenyl)amino)benzoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-(2,3-dichloroanilino)benzoic acid (CAS 4295-55-0) is a chemical compound with the molecular formula C13H9Cl2NO2 and a molecular weight of 282.12 g/mol. IUPAC name: 2-(2,3-dichloroanilino)benzoic acid. InChIKey: JONFYSWOLCTYFK-UHFFFAOYSA-N.
| Molecular formula | C13H9Cl2NO2 |
|---|---|
| Molecular weight | 282.12 g/mol |
| IUPAC name | 2-(2,3-dichloroanilino)benzoic acid |
| InChIKey | JONFYSWOLCTYFK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)NC2=C(C(=CC=C2)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
Clofenamic acid, Acido clofenamico, Acide clofenamique, Acidum clofenamicum, 2-[(2,3-dichlorophenyl)amino]benzoic acid, N-(2,3-Dichlorphenyl)anthranilsaeure, 2-((2,3-Dichlorophenyl)amino)benzoic acid, 2-(2,3-dichloroanilino)benzoic acid, Clofenamic acid [INN], N-(2,3-Dichlorophenyl)anthranilic acid