CAS 42961-77-3 appears in our catalog under these names: Carvedilol Impurity 9 HCl, 5-Amino-[1,1'-biphenyl]-2-ol hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-amino-2-phenylphenol;hydrochloride (CAS 42961-77-3) is a chemical compound with the molecular formula C12H12ClNO and a molecular weight of 221.68 g/mol. IUPAC name: 4-amino-2-phenylphenol;hydrochloride. InChIKey: BYFJQAZKIBIOIW-UHFFFAOYSA-N.
| Molecular formula | C12H12ClNO |
|---|---|
| Molecular weight | 221.68 g/mol |
| IUPAC name | 4-amino-2-phenylphenol;hydrochloride |
| InChIKey | BYFJQAZKIBIOIW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=CC(=C2)N)O.Cl |
Computed by PubChem (NCBI)