Products 43043-08-9
CAS 43043-08-9 is the registry number for Isoedultin. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[(8S,9R)-9-acetyloxy-2-oxo-8,9-dihydrofuro[2,3-h]chromen-8-yl]propan-2-yl (Z)-2-methylbut-2-enoate (CAS 43043-08-9) is a chemical compound with the molecular formula C21H22O7 and a molecular weight of 386.4 g/mol. IUPAC name: 2-[(8S,9R)-9-acetyloxy-2-oxo-8,9-dihydrofuro[2,3-h]chromen-8-yl]propan-2-yl (Z)-2-methylbut-2-enoate. InChIKey: UGPGHYBHAGRUHW-JZWAJAMXSA-N.
| Molecular formula | C21H22O7 |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | 2-[(8S,9R)-9-acetyloxy-2-oxo-8,9-dihydrofuro[2,3-h]chromen-8-yl]propan-2-yl (Z)-2-methylbut-2-enoate |
| InChIKey | UGPGHYBHAGRUHW-JZWAJAMXSA-N |
| SMILES | C/C=C(/C)\C(=O)OC(C)(C)[C@@H]1[C@@H](C2=C(O1)C=CC3=C2OC(=O)C=C3)OC(=O)C |
Computed by PubChem (NCBI)
Synonyms:
Isoedultin, orb3178168