CAS 4308-27-4 is the registry number for 2-(3,4-Dichlorophenyl)-1H-imidazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3,4-dichlorophenyl)-1H-imidazole (CAS 4308-27-4) is a chemical compound with the molecular formula C9H6Cl2N2 and a molecular weight of 213.06 g/mol. IUPAC name: 2-(3,4-dichlorophenyl)-1H-imidazole. InChIKey: KYJUUIWHGMPQDN-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2N2 |
|---|---|
| Molecular weight | 213.06 g/mol |
| IUPAC name | 2-(3,4-dichlorophenyl)-1H-imidazole |
| InChIKey | KYJUUIWHGMPQDN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=NC=CN2)Cl)Cl |
Computed by PubChem (NCBI)