CAS 4311-12-0 appears in our catalog under these names: H–Gln(isopropyl)–OH, H-GLN(ISOPROPYL)-OH, 97%, 97%, H-GLN(ISOPROPYL)-OH, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
N-isopropyl-L-glutamine is a N5-alkylglutamine where the alkyl group is isopropyl. It has a role as a bacterial metabolite. It is a tautomer of a N-isopropyl-L-glutamine zwitterion.
Source: ChEBI
| Molecular formula | C8H16N2O3 |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | (2S)-2-amino-5-oxo-5-(propan-2-ylamino)pentanoic acid |
| InChIKey | CABXGBMKSVRWOG-LURJTMIESA-N |
| SMILES | CC(C)NC(=O)CC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)