Products 4312-44-1
CAS 4312-44-1 appears in our catalog under these names: 6-Hydroxyquinoline-4-carboxylic acid, 97%, 6–Hydroxy–4–quinolinecarboxylic acid, 6-Hydroxyquinoline-4-carboxylic acid, 6-Hydroxyquinoline-4-carboxylic acid 95%, 6-Hydroxyquinoline-4-carboxylic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 50mg, 2g, 10g, 25g, 100mg.
6-hydroxyquinoline-4-carboxylic acid (CAS 4312-44-1) is a chemical compound with the molecular formula C10H7NO3 and a molecular weight of 189.17 g/mol. IUPAC name: 6-hydroxyquinoline-4-carboxylic acid. InChIKey: UVKYGKPXDDWMIV-UHFFFAOYSA-N.
| Molecular formula | C10H7NO3 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 6-hydroxyquinoline-4-carboxylic acid |
| InChIKey | UVKYGKPXDDWMIV-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=CC(=C2C=C1O)C(=O)O |
Computed by PubChem (NCBI)