CAS 4319-98-6 appears in our catalog under these names: 2,4,6-Trimethoxypyrimidine-5-carboxylic acid, 97%, 97%, 2,4,6-Trimethoxypyrimidine-5-carboxylic acid, 97%. Offered by: Chemat, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g.
2,4,6-trimethoxypyrimidine-5-carboxylic acid (CAS 4319-98-6) is a chemical compound with the molecular formula C8H10N2O5 and a molecular weight of 214.18 g/mol. IUPAC name: 2,4,6-trimethoxypyrimidine-5-carboxylic acid. InChIKey: JUCMPPTZDKQMAT-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O5 |
|---|---|
| Molecular weight | 214.18 g/mol |
| IUPAC name | 2,4,6-trimethoxypyrimidine-5-carboxylic acid |
| InChIKey | JUCMPPTZDKQMAT-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=NC(=N1)OC)OC)C(=O)O |
Computed by PubChem (NCBI)