Products 65422-98-2

CAS 65422-98-2 is the registry number for 3,4-Diethyl 1,2,5-oxadiazole-3,4-dicarboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Diethyl 1,2,5-oxadiazole-3,4-dicarboxylate (CAS 65422-98-2) is a chemical compound with the molecular formula C8H10N2O5 and a molecular weight of 214.18 g/mol. IUPAC name: diethyl 1,2,5-oxadiazole-3,4-dicarboxylate. InChIKey: GWQHRMDHUWRYPI-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10N2O5
Molecular weight214.18 g/mol
IUPAC namediethyl 1,2,5-oxadiazole-3,4-dicarboxylate
InChIKeyGWQHRMDHUWRYPI-UHFFFAOYSA-N
SMILESCCOC(=O)C1=NON=C1C(=O)OCC

Computed by PubChem (NCBI)