CAS 431942-30-2 is the registry number for 5-Bromo-2-phenylfuro[2,3-b]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-bromo-2-phenylfuro[2,3-b]pyridine (CAS 431942-30-2) is a chemical compound with the molecular formula C13H8BrNO and a molecular weight of 274.11 g/mol. IUPAC name: 5-bromo-2-phenylfuro[2,3-b]pyridine. InChIKey: GDEUCQHGCNNNOT-UHFFFAOYSA-N.
| Molecular formula | C13H8BrNO |
|---|---|
| Molecular weight | 274.11 g/mol |
| IUPAC name | 5-bromo-2-phenylfuro[2,3-b]pyridine |
| InChIKey | GDEUCQHGCNNNOT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=CC(=CN=C3O2)Br |
Computed by PubChem (NCBI)