CAS 73552-42-8 appears in our catalog under these names: 2-(2-Bromophenyl)-1,3-benzoxazole, 95%, 2-(2-Bromophenyl)benzo[d]oxazole, 98%(GC),RG, 98%(GC),RG, 2-(2-bromophenyl)-1,3-benzoxazole. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 250mg.
2-(2-bromophenyl)-1,3-benzoxazole (CAS 73552-42-8) is a chemical compound with the molecular formula C13H8BrNO and a molecular weight of 274.11 g/mol. IUPAC name: 2-(2-bromophenyl)-1,3-benzoxazole. InChIKey: IAOINCALAKEDML-UHFFFAOYSA-N.
| Molecular formula | C13H8BrNO |
|---|---|
| Molecular weight | 274.11 g/mol |
| IUPAC name | 2-(2-bromophenyl)-1,3-benzoxazole |
| InChIKey | IAOINCALAKEDML-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC3=CC=CC=C3O2)Br |
Computed by PubChem (NCBI)