CAS 537025-33-5 appears in our catalog under these names: Benzoxazole, 6-bromo-2-phenyl-, 95%, 6–Bromo–2–phenylbenzoxazole, 6-Bromo-2-phenylbenzo[d]oxazole 97%, 6-Bromo-2-phenylbenzoxazole, 97%, 97%, BENZOXAZOLE, 6-BROMO-2-PHENYL-, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g.
6-bromo-2-phenyl-1,3-benzoxazole (CAS 537025-33-5) is a chemical compound with the molecular formula C13H8BrNO and a molecular weight of 274.11 g/mol. IUPAC name: 6-bromo-2-phenyl-1,3-benzoxazole. InChIKey: YVZIBDQASKHGFK-UHFFFAOYSA-N.
| Molecular formula | C13H8BrNO |
|---|---|
| Molecular weight | 274.11 g/mol |
| IUPAC name | 6-bromo-2-phenyl-1,3-benzoxazole |
| InChIKey | YVZIBDQASKHGFK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=C(O2)C=C(C=C3)Br |
Computed by PubChem (NCBI)