CAS 69918-19-0 appears in our catalog under these names: 5-Bromo-2-phenyl-1,3-benzoxazole, 95%, 5-Bromo-2-phenylbenzo[d]oxazole 95+%, 5-Bromo-2-phenylbenzo[d]oxazole, 95+%, 95+%, 5-Bromo-2-phenyl-1,3-benzoxazole, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 250mg, 5g.
5-bromo-2-phenyl-1,3-benzoxazole (CAS 69918-19-0) is a chemical compound with the molecular formula C13H8BrNO and a molecular weight of 274.11 g/mol. IUPAC name: 5-bromo-2-phenyl-1,3-benzoxazole. InChIKey: WOTNVYMPQOWYSY-UHFFFAOYSA-N.
| Molecular formula | C13H8BrNO |
|---|---|
| Molecular weight | 274.11 g/mol |
| IUPAC name | 5-bromo-2-phenyl-1,3-benzoxazole |
| InChIKey | WOTNVYMPQOWYSY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=C(O2)C=CC(=C3)Br |
Computed by PubChem (NCBI)