CAS 4320-83-6 appears in our catalog under these names: 4-Phenylisoxazol-5-amine, 95%, 4-Phenylisoxazol-5-amine, 95+%, 4-Phenyl-isoxazol-5-ylamine, 95%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
4-phenyl-1,2-oxazol-5-amine (CAS 4320-83-6) is a chemical compound with the molecular formula C9H8N2O and a molecular weight of 160.17 g/mol. IUPAC name: 4-phenyl-1,2-oxazol-5-amine. InChIKey: HFTKSZSXETZARM-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | 4-phenyl-1,2-oxazol-5-amine |
| InChIKey | HFTKSZSXETZARM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(ON=C2)N |
Computed by PubChem (NCBI)