Products 434-42-4
CAS 434-42-4 appears in our catalog under these names: (1-Bromo-2,2,2-trifluoroethyl)benzene, (1-Bromo-2,2,2-trifluoroethyl)benzene 95%, (1-Bromo-2,2,2-trifluoroethyl)benzene, 95%, 95%, (1-BROMO-2,2,2-TRIFLUOROETHYL)BENZENE, &, (1-Bromo-2,2,2-trifluoro-ethyl)-benzene, 95%. Offered by: Biosynth, Ambeed, Chemat, Sigma-Aldrich, Fluorochem. Available pack sizes: 2,5g, 100mg, 250mg, 1g, 5g, 500MG.
(1-bromo-2,2,2-trifluoroethyl)benzene (CAS 434-42-4) is a chemical compound with the molecular formula C8H6BrF3 and a molecular weight of 239.03 g/mol. IUPAC name: (1-bromo-2,2,2-trifluoroethyl)benzene. InChIKey: IRICHAOGAOFEQI-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF3 |
|---|---|
| Molecular weight | 239.03 g/mol |
| IUPAC name | (1-bromo-2,2,2-trifluoroethyl)benzene |
| InChIKey | IRICHAOGAOFEQI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(F)(F)F)Br |
Computed by PubChem (NCBI)