Products 435342-08-8

CAS 435342-08-8 is the registry number for 3-(2-Isopropyl-benzoimidazol-1-yl)-2-methyl-propionic acid. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.

Structural formula: {0} (CAS {1})

2-methyl-3-(2-propan-2-ylbenzimidazol-1-yl)propanoic acid (CAS 435342-08-8) is a chemical compound with the molecular formula C14H18N2O2 and a molecular weight of 246.30 g/mol. IUPAC name: 2-methyl-3-(2-propan-2-ylbenzimidazol-1-yl)propanoic acid. InChIKey: QUXGGGMURXCUCP-UHFFFAOYSA-N.

Identity
Molecular formulaC14H18N2O2
Molecular weight246.30 g/mol
IUPAC name2-methyl-3-(2-propan-2-ylbenzimidazol-1-yl)propanoic acid
InChIKeyQUXGGGMURXCUCP-UHFFFAOYSA-N
SMILESCC(C)C1=NC2=CC=CC=C2N1CC(C)C(=O)O

Computed by PubChem (NCBI)