CAS 4355-15-1 appears in our catalog under these names: Gabapentin Impurity 1, alpha,alpha'-Dicyano-1,1-cyclohexanediacetamide. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1g.
2,4-dioxo-3-azaspiro[5.5]undecane-1,5-dicarbonitrile (CAS 4355-15-1) is a chemical compound with the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. IUPAC name: 2,4-dioxo-3-azaspiro[5.5]undecane-1,5-dicarbonitrile. InChIKey: YDDZHTSOBDNNMZ-UHFFFAOYSA-N.
| Molecular formula | C12H13N3O2 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | 2,4-dioxo-3-azaspiro[5.5]undecane-1,5-dicarbonitrile |
| InChIKey | YDDZHTSOBDNNMZ-UHFFFAOYSA-N |
| SMILES | C1CCC2(CC1)C(C(=O)NC(=O)C2C#N)C#N |
Computed by PubChem (NCBI)