Products 4360-62-7
CAS 4360-62-7 is the registry number for 2-(4-Bromophenyl)-2-methyl-1,3-dioxolane, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 100g, 25g, 5g, 1g.
2-[bromo(phenyl)methyl]-1,3-dioxolane (CAS 4360-62-7) is a chemical compound with the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. IUPAC name: 2-[bromo(phenyl)methyl]-1,3-dioxolane. InChIKey: ANYIXZCZRQIADU-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO2 |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | 2-[bromo(phenyl)methyl]-1,3-dioxolane |
| InChIKey | ANYIXZCZRQIADU-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C(C2=CC=CC=C2)Br |
Computed by PubChem (NCBI)