Products 436089-48-4
CAS 436089-48-4 is the registry number for 4,5-Dimethyl-3-(4-methylbenzoyl)thiophen-2-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(2-amino-4,5-dimethylthiophen-3-yl)-(4-methylphenyl)methanone (CAS 436089-48-4) is a chemical compound with the molecular formula C14H15NOS and a molecular weight of 245.34 g/mol. IUPAC name: (2-amino-4,5-dimethylthiophen-3-yl)-(4-methylphenyl)methanone. InChIKey: KNLPGBYZTLBBHO-UHFFFAOYSA-N.
| Molecular formula | C14H15NOS |
|---|---|
| Molecular weight | 245.34 g/mol |
| IUPAC name | (2-amino-4,5-dimethylthiophen-3-yl)-(4-methylphenyl)methanone |
| InChIKey | KNLPGBYZTLBBHO-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)C2=C(SC(=C2C)C)N |
Computed by PubChem (NCBI)