CAS 4378-10-3 appears in our catalog under these names: H–Thr(Bzl)–OH, O-Benzyl-L-threonine, H-Thr(Bzl)-OH 98%, O-(Phenylmethyl)-L-Threonine, 98%, 98%. Offered by: GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 5g, 2g, 10g, 25g, 50g, 250mg.
(2S,3R)-2-amino-3-phenylmethoxybutanoic acid (CAS 4378-10-3) is a chemical compound with the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. IUPAC name: (2S,3R)-2-amino-3-phenylmethoxybutanoic acid. InChIKey: ONOURAAVVKGJNM-SCZZXKLOSA-N.
| Molecular formula | C11H15NO3 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | (2S,3R)-2-amino-3-phenylmethoxybutanoic acid |
| InChIKey | ONOURAAVVKGJNM-SCZZXKLOSA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)N)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)