CAS 438049-64-0 appears in our catalog under these names: {6-((2-fluorophenyl)methoxy)pyridin-3-yl}methanol, 95%, {6-((2-Fluorophenyl)methoxy)pyridin-3-yl}methanol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
[6-[(2-fluorophenyl)methoxy]-3-pyridinyl]methanol (CAS 438049-64-0) is a chemical compound with the molecular formula C13H12FNO2 and a molecular weight of 233.24 g/mol. IUPAC name: [6-[(2-fluorophenyl)methoxy]-3-pyridinyl]methanol. InChIKey: DOXVPIRIYIEGAA-UHFFFAOYSA-N.
| Molecular formula | C13H12FNO2 |
|---|---|
| Molecular weight | 233.24 g/mol |
| IUPAC name | [6-[(2-fluorophenyl)methoxy]-3-pyridinyl]methanol |
| InChIKey | DOXVPIRIYIEGAA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)COC2=NC=C(C=C2)CO)F |
Computed by PubChem (NCBI)