Products 1926163-88-3
CAS 1926163-88-3 appears in our catalog under these names: Fmoc-alpha-me-ser-lactone, 95%, Fmoc–α–Me–Ser–lactone. Offered by: Combi-blocks, GLPBio. Available pack sizes: 100mg, 1g, 250mg.
9H-fluoren-9-ylmethyl N-[(3S)-3-methyl-2-oxooxetan-3-yl]carbamate (CAS 1926163-88-3) is a chemical compound with the molecular formula C19H17NO4 and a molecular weight of 323.3 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-[(3S)-3-methyl-2-oxooxetan-3-yl]carbamate. InChIKey: WSBOCHIWURUNHG-IBGZPJMESA-N.
| Molecular formula | C19H17NO4 |
|---|---|
| Molecular weight | 323.3 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-[(3S)-3-methyl-2-oxooxetan-3-yl]carbamate |
| InChIKey | WSBOCHIWURUNHG-IBGZPJMESA-N |
| SMILES | C[C@@]1(COC1=O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)